Online Database of Chemicals from Around the World
| Name | 1-(2-Methylnaphthyl)-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-(2-Methyl-1-Naphthyl)Pyrrole-2,5-Dione; 1-(2-Methyl-1-Naphthyl)-3-Pyrroline-2,5-Quinone; N-(2-Methyl-1-Naphthyl)Maleimide |
| Molecular Structure |  |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 70017-56-0 |
| EINECS | 274-255-3 |
| SMILES | C1=CC3=C(C(=C1C)N2C(C=CC2=O)=O)C=CC=C3 |
| InChI | 1S/C15H11NO2/c1-10-6-7-11-4-2-3-5-12(11)15(10)16-13(17)8-9-14(16)18/h2-9H,1H3 |
| InChIKey | MEZJQXVOMGUAMP-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.448°C at 760 mmHg (Cal.) |
| Flash point | 193.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methylnaphthyl)-1H-Pyrrole-2,5-Dione |
