|
CAS#: 7008-18-6 Product: Iminophenimide No suppilers available for the product. |
| Name | Iminophenimide |
|---|---|
| Synonyms | 3-Ethyl-3-Phenyl-Piperazine-2,6-Dione; 3-Ethyl-3-Phenyl-Piperazine-2,6-Quinone; 3-Ethyl-3-Phenyl-2,6-Piperazindion |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 7008-18-6 |
| SMILES | C2=C(C1(C(NC(=O)CN1)=O)CC)C=CC=C2 |
| InChI | 1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)11(16)14-10(15)8-13-12/h3-7,13H,2,8H2,1H3,(H,14,15,16) |
| InChIKey | ANPJDCDLXKNSPS-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.212°C at 760 mmHg (Cal.) |
| Flash point | 174.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iminophenimide |