|
CAS#: 70132-46-6 Product: 1-Diethylamino-3-(2-Nitroimidazol-1-Yl)Propan-2-Ol No suppilers available for the product. |
| Name | 1-Diethylamino-3-(2-Nitroimidazol-1-Yl)Propan-2-Ol |
|---|---|
| Synonyms | 1-Diethylamino-3-(2-Nitro-1-Imidazolyl)Propan-2-Ol; Nsc307216 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 |
| CAS Registry Number | 70132-46-6 |
| SMILES | C1=CN=C([N]1CC(O)CN(CC)CC)[N+]([O-])=O |
| InChI | 1S/C10H18N4O3/c1-3-12(4-2)7-9(15)8-13-6-5-11-10(13)14(16)17/h5-6,9,15H,3-4,7-8H2,1-2H3 |
| InChIKey | PUYVBJPMTDIJSY-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.864°C at 760 mmHg (Cal.) |
| Flash point | 221.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Diethylamino-3-(2-Nitroimidazol-1-Yl)Propan-2-Ol |