|
CAS#: 70172-00-8 Product: 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Buten-2-Ol No suppilers available for the product. |
| Name | 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Buten-2-Ol |
|---|---|
| Synonyms | Alpha-Methylionol; Isomethyl-.Alpha.-Ionol; 3-Buten-2-Ol, 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 70172-00-8 |
| SMILES | CC1(C(C(=CCC1)C)\C=C(C(O)C)/C)C |
| InChI | 1S/C14H24O/c1-10-7-6-8-14(4,5)13(10)9-11(2)12(3)15/h7,9,12-13,15H,6,8H2,1-5H3/b11-9+ |
| InChIKey | LDDHQAGSKKNKSB-PKNBQFBNSA-N |
| Density | 0.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.296°C at 760 mmHg (Cal.) |
| Flash point | 101.128°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Buten-2-Ol |