|
CAS#: 70223-10-8 Product: 6-Ketocholestanol No suppilers available for the product. |
| Name | 6-Ketocholestanol |
|---|---|
| Synonyms | (3S,8S,9S,10R,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-3-Hydroxy-10,13-Dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-Tetradecahydrocyclopenta[A]Phenanthren-6-One; Cholestan-6-One, 3-Hydroxy-, (3Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 |
| CAS Registry Number | 70223-10-8 |
| SMILES | [C@]34([C@@H]2[C@H]([C@H]1[C@@]([C@H](CC1)[C@@H](CCCC(C)C)C)(CC2)C)CC(C3C[C@H](CC4)O)=O)C |
| InChI | 1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-16-25(29)24-15-19(28)11-13-27(24,5)23(20)12-14-26(21,22)4/h17-24,28H,6-16H2,1-5H3/t18-,19+,20+,21-,22+,23+,24?,26-,27-/m1/s1 |
| InChIKey | JQMQKOQOLPGBBE-DNFLUMAFSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.285°C at 760 mmHg (Cal.) |
| Flash point | 212.398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ketocholestanol |