|
CAS#: 70486-05-4 Product: 3-Chloro-6-Phenyl-4-(1-Piperidyl)Pyran-2-One No suppilers available for the product. |
| Name | 3-Chloro-6-Phenyl-4-(1-Piperidyl)Pyran-2-One |
|---|---|
| Synonyms | 3-Chloro-6-Phenyl-4-(1-Piperidyl)Pyran-2-One; 3-Chloro-6-Phenyl-4-(1-Piperidyl)-2-Pyranone; 3-Chloro-6-Phenyl-4-Piperidino-Pyran-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 |
| CAS Registry Number | 70486-05-4 |
| SMILES | C3=C(C1=CC(=C(Cl)C(O1)=O)N2CCCCC2)C=CC=C3 |
| InChI | 1S/C16H16ClNO2/c17-15-13(18-9-5-2-6-10-18)11-14(20-16(15)19)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | DTPIBYOZZPKARH-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.795°C at 760 mmHg (Cal.) |
| Flash point | 194.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-6-Phenyl-4-(1-Piperidyl)Pyran-2-One |