|
CAS#: 70529-35-0 Product: Itazigrel No suppilers available for the product. |
| Name | Itazigrel |
|---|---|
| Synonyms | 4,5-Bis(4-Methoxyphenyl)-2-(Trifluoromethyl)Thiazole; Ly 108048; Itazogrel |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14F3NO2S |
| Molecular Weight | 365.37 |
| CAS Registry Number | 70529-35-0 |
| SMILES | C3=C(C2=C(C1=CC=C(C=C1)OC)SC(=N2)C(F)(F)F)C=CC(=C3)OC |
| InChI | 1S/C18H14F3NO2S/c1-23-13-7-3-11(4-8-13)15-16(25-17(22-15)18(19,20)21)12-5-9-14(24-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | CIPBQTCSXVEDSG-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.332°C at 760 mmHg (Cal.) |
| Flash point | 195.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Itazigrel |