|
CAS#: 70539-83-2 Product: N-Desmethylstobadine No suppilers available for the product. |
| Name | N-Desmethylstobadine |
|---|---|
| Synonyms | Ndms; 1H-Pyrido(4,3-B)Indole, 2,3,4,4A,5,9B-Hexahydro-8-Methyl-, Trans-; N-Desmethylstobadine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 |
| CAS Registry Number | 70539-83-2 |
| SMILES | [C@H]12NC3=C([C@@H]1CNCC2)C=C(C=C3)C |
| InChI | 1S/C12H16N2/c1-8-2-3-11-9(6-8)10-7-13-5-4-12(10)14-11/h2-3,6,10,12-14H,4-5,7H2,1H3/t10-,12+/m0/s1 |
| InChIKey | XYIPZQCDLAFBSX-CMPLNLGQSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.517°C at 760 mmHg (Cal.) |
| Flash point | 187.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Desmethylstobadine |