|
CAS#: 70551-97-2 Product: 5-(2,4-Dichlorophenyl)-3-Methylthio-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(2,4-Dichlorophenyl)-3-Methylthio-1,2,4-Triazine |
|---|---|
| Synonyms | 5-(3,4-Dichlorophenyl)-3-(Methylthio)-1,2,4-Triazine; 1,2,4-Triazine, 5-(2,4-Dichlorophenyl)-3-(Methylthio)-; 5-(2,4-Dichlorophenyl)-3-(Methylthio)-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7Cl2N3S |
| Molecular Weight | 272.15 |
| CAS Registry Number | 70551-97-2 |
| SMILES | C1=C(N=C(N=N1)SC)C2=CC=C(C(=C2)Cl)Cl |
| InChI | 1S/C10H7Cl2N3S/c1-16-10-14-9(5-13-15-10)6-2-3-7(11)8(12)4-6/h2-5H,1H3 |
| InChIKey | CJAWFQLKCCEWPW-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.763°C at 760 mmHg (Cal.) |
| Flash point | 233.671°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2,4-Dichlorophenyl)-3-Methylthio-1,2,4-Triazine |