|
CAS#: 70648-22-5 Product: 1,2,8,9-Tetrachlorodibenzofuran No suppilers available for the product. |
| Name | 1,2,8,9-Tetrachlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,8,9-Tetrachloro |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl4O |
| Molecular Weight | 305.98 |
| CAS Registry Number | 70648-22-5 |
| SMILES | C1=C(C(=C2C(=C1)OC3=C2C(=C(C=C3)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H4Cl4O/c13-5-1-3-7-9(11(5)15)10-8(17-7)4-2-6(14)12(10)16/h1-4H |
| InChIKey | OHYCQUKMNPHFPT-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.248°C at 760 mmHg (Cal.) |
| Flash point | 208.564°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,8,9-Tetrachlorodibenzofuran |