|
CAS#: 70729-60-1 Product: Ethyl (2-(ethyl(3-methylphenyl)amino)phenyl)carbamate No suppilers available for the product. |
| Name | Ethyl (2-(ethyl(3-methylphenyl)amino)phenyl)carbamate |
|---|---|
| Synonyms | N-[2-[Ethyl-(3-Methylphenyl)Amino]Phenyl]Carbamic Acid Ethyl Ester; Ethyl (2-(Ethyl(3-Methylphenyl)Amino)Phenyl)Carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 70729-60-1 |
| EINECS | 274-824-6 |
| SMILES | C1=C(C=C(C=C1)N(C2=C(C=CC=C2)NC(=O)OCC)CC)C |
| InChI | 1S/C18H22N2O2/c1-4-20(15-10-8-9-14(3)13-15)17-12-7-6-11-16(17)19-18(21)22-5-2/h6-13H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | WYZVJXUEYWUVMU-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.582°C at 760 mmHg (Cal.) |
| Flash point | 198.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2-(ethyl(3-methylphenyl)amino)phenyl)carbamate |