|
CAS#: 70766-53-9 Product: 4-(1,1-Dimethylethyl)-2,3,6-Trimethylphenol No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)-2,3,6-Trimethylphenol |
|---|---|
| Synonyms | 4-Tert-Butyl-2,3,6-Trimethyl-Phenol; 2,3,6-Trimethyl-4-Tert-Butylphenol; Phenol, 4-(1,1-Dimethylethyl)-2,3,6-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 70766-53-9 |
| SMILES | C1=C(C(=C(C(=C1C(C)(C)C)C)C)O)C |
| InChI | 1S/C13H20O/c1-8-7-11(13(4,5)6)9(2)10(3)12(8)14/h7,14H,1-6H3 |
| InChIKey | RYOYKAIHYPDPGL-UHFFFAOYSA-N |
| Density | 0.946g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.361°C at 760 mmHg (Cal.) |
| Flash point | 124.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)-2,3,6-Trimethylphenol |