|
CAS#: 70784-97-3 Product: 1-Chloro-4-[(2-(Methylsulfonyl)Ethenyl]-Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-[(2-(Methylsulfonyl)Ethenyl]-Benzene |
|---|---|
| Synonyms | 1-Chloro-4-[(E)-2-Methylsulfonylvinyl]Benzene; 1-Chloro-4-[(E)-2-Mesylvinyl]Benzene; Benzene, 1-Chloro-4-((2-(Methylsulfonyl)Ethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClO2S |
| Molecular Weight | 216.68 |
| CAS Registry Number | 70784-97-3 |
| SMILES | C1=C(\C=C\[S](=O)(=O)C)C=CC(=C1)Cl |
| InChI | 1S/C9H9ClO2S/c1-13(11,12)7-6-8-2-4-9(10)5-3-8/h2-7H,1H3/b7-6+ |
| InChIKey | KGARFKLLCJQQEZ-VOTSOKGWSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.344°C at 760 mmHg (Cal.) |
| Flash point | 199.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[(2-(Methylsulfonyl)Ethenyl]-Benzene |