|
CAS#: 71130-09-1 Product: 2-(Dimethylamino)-3,5,6-Trimethyl-2,5-Cyclohexadiene-1,4-Dione No suppilers available for the product. |
| Name | 2-(Dimethylamino)-3,5,6-Trimethyl-2,5-Cyclohexadiene-1,4-Dione |
|---|---|
| Synonyms | 2-Dimethylamino-3,5,6-Trimethyl-1,4-Benzoquinone; 2-Dimethylamino-3,5,6-Trimethyl-P-Benzoquinone; 2-Dimethylamino-3,5,6-Trimethyl-Cyclohexa-2,5-Diene-1,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 71130-09-1 |
| SMILES | CC1=C(C(=O)C(=C(C1=O)N(C)C)C)C |
| InChI | 1S/C11H15NO2/c1-6-7(2)11(14)9(12(4)5)8(3)10(6)13/h1-5H3 |
| InChIKey | AOKBCZUSVVIVSQ-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.469°C at 760 mmHg (Cal.) |
| Flash point | 105.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)-3,5,6-Trimethyl-2,5-Cyclohexadiene-1,4-Dione |