|
CAS#: 71154-41-1 Product: 2-Naphthylethyl Methacrylate No suppilers available for the product. |
| Name | 2-Naphthylethyl Methacrylate |
|---|---|
| Synonyms | 2-(2-Naphthyl)Ethyl 2-Methylprop-2-Enoate; 2-Methylprop-2-Enoic Acid 2-(2-Naphthyl)Ethyl Ester; 2-Methylacrylic Acid 2-(2-Naphthyl)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 71154-41-1 |
| SMILES | C1=C2C(=CC=C1CCOC(C(=C)C)=O)C=CC=C2 |
| InChI | 1S/C16H16O2/c1-12(2)16(17)18-10-9-13-7-8-14-5-3-4-6-15(14)11-13/h3-8,11H,1,9-10H2,2H3 |
| InChIKey | UGRAJKVJLIUYIH-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.717°C at 760 mmHg (Cal.) |
| Flash point | 239.785°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Naphthylethyl Methacrylate |