|
CAS#: 71172-26-4 Product: (4-Methoxyphenyl)Methyl Isobutyrate No suppilers available for the product. |
| Name | (4-Methoxyphenyl)Methyl Isobutyrate |
|---|---|
| Synonyms | 2-Methylpropanoic Acid (4-Methoxyphenyl)Methyl Ester; 2-Methylpropionic Acid (4-Methoxybenzyl) Ester; (4-Methoxyphenyl)Methyl Isobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 71172-26-4 |
| EINECS | 275-227-3 |
| SMILES | C1=C(COC(=O)C(C)C)C=CC(=C1)OC |
| InChI | 1S/C12H16O3/c1-9(2)12(13)15-8-10-4-6-11(14-3)7-5-10/h4-7,9H,8H2,1-3H3 |
| InChIKey | ZOXXODFRADWDHG-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.527°C at 760 mmHg (Cal.) |
| Flash point | 112.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Methoxyphenyl)Methyl Isobutyrate |