|
CAS#: 71195-56-7 Product: Broclepride No suppilers available for the product. |
| Name | Broclepride |
|---|---|
| Synonyms | 4-Amino-5-Bromo-N-[1-[(4-Chlorophenyl)Methyl]-4-Piperidyl]-2-Methoxy-Benzamide; 4-Amino-5-Bromo-N-[1-[(4-Chlorophenyl)Methyl]-4-Piperidinyl]-2-Methoxybenzamide; 4-Amino-5-Bromo-N-[1-(4-Chlorobenzyl)-4-Piperidyl]-2-Methoxy-Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23BrClN3O2 |
| Molecular Weight | 452.78 |
| CAS Registry Number | 71195-56-7 |
| SMILES | C1=C(C(=CC(=C1Br)N)OC)C(NC3CCN(CC2=CC=C(Cl)C=C2)CC3)=O |
| InChI | 1S/C20H23BrClN3O2/c1-27-19-11-18(23)17(21)10-16(19)20(26)24-15-6-8-25(9-7-15)12-13-2-4-14(22)5-3-13/h2-5,10-11,15H,6-9,12,23H2,1H3,(H,24,26) |
| InChIKey | OVUIZYRVFCENSZ-UHFFFAOYSA-N |
| Density | 1.478g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.001°C at 760 mmHg (Cal.) |
| Flash point | 287.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Broclepride |