|
CAS#: 71209-67-1 Product: 3-Chloro-3-(4-Methylphenyl)Methacrylaldehyde No suppilers available for the product. |
| Name | 3-Chloro-3-(4-Methylphenyl)Methacrylaldehyde |
|---|---|
| Synonyms | (Z)-3-Chloro-2-Methyl-3-(4-Methylphenyl)Acrolein; 3-Chloro-3-(4-Methylphenyl)Methacrylaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 |
| CAS Registry Number | 71209-67-1 |
| EINECS | 275-264-5 |
| SMILES | C1=C(\C(Cl)=C(C=O)/C)C=CC(=C1)C |
| InChI | 1S/C11H11ClO/c1-8-3-5-10(6-4-8)11(12)9(2)7-13/h3-7H,1-2H3/b11-9- |
| InChIKey | MLERDVFIFKHLCJ-LUAWRHEFSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.924°C at 760 mmHg (Cal.) |
| Flash point | 152.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-3-(4-Methylphenyl)Methacrylaldehyde |