|
CAS#: 71236-10-7 Product: 2-(3-(2'-Chlorophenoxy)Phenyl)Propionic Acid No suppilers available for the product. |
| Name | 2-(3-(2'-Chlorophenoxy)Phenyl)Propionic Acid |
|---|---|
| Synonyms | 2-[3-(2-Chlorophenoxy)Phenyl]Propionic Acid; Benzeneacetic Acid, 3-(2-Chlorophenoxy)-Alpha-Methyl-, (+-)-; Cpoppa |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 |
| CAS Registry Number | 71236-10-7 |
| SMILES | C1=C(C=CC=C1C(C(=O)O)C)OC2=CC=CC=C2Cl |
| InChI | 1S/C15H13ClO3/c1-10(15(17)18)11-5-4-6-12(9-11)19-14-8-3-2-7-13(14)16/h2-10H,1H3,(H,17,18) |
| InChIKey | DBYOODVQQKIUTD-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.349°C at 760 mmHg (Cal.) |
| Flash point | 191.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-(2'-Chlorophenoxy)Phenyl)Propionic Acid |