| Name | methyl 8-acetoxy-2-methoxy-9-oxo-xanthene-1-carboxylate |
|---|---|
| Synonyms | methyl 8-acetoxy-2-methoxy-9-oxo-xanthene-1-carboxylate; Mycoxanthone acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 |
| CAS Registry Number | 71326-06-2 |
| SMILES | CC(=O)Oc1cccc2c1c(=O)c3c(o2)ccc(c3C(=O)OC)OC |
| InChI | 1S/C18H14O7/c1-9(19)24-11-5-4-6-12-14(11)17(20)15-13(25-12)8-7-10(22-2)16(15)18(21)23-3/h4-8H,1-3H3 |
| InChIKey | JHWFDPDPTSCZRT-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.042°C at 760 mmHg (Cal.) |
| Flash point | 228.272°C (Cal.) |
| (1) | Assante G. Mycochromone and mycoxanthone: Two new metabolites from Mycosphaerella rosigena, Phytochemistry, 1979 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for methyl 8-acetoxy-2-methoxy-9-oxo-xanthene-1-carboxylate |