|
CAS#: 71360-45-7 Product: Chloroxymorphamine No suppilers available for the product. |
| Name | Chloroxymorphamine |
|---|---|
| Synonyms | Chloroxymorphamine; Morphinan-3,14-Diol, 6-(Bis(2-Chloroethyl)Amino)-4,5-Epoxy-17-Methyl-, (5Alpha,6Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28Cl2N2O3 |
| Molecular Weight | 427.37 |
| CAS Registry Number | 71360-45-7 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@]1(CC[C@H]([C@@H]2OC3=C(C=C4)O)N(CCCl)CCCl)O)CCN5C |
| InChI | 1S/C21H28Cl2N2O3/c1-24-9-6-20-17-13-2-3-15(26)18(17)28-19(20)14(25(10-7-22)11-8-23)4-5-21(20,27)16(24)12-13/h2-3,14,16,19,26-27H,4-12H2,1H3/t14-,16-,19+,20+,21-/m1/s1 |
| InChIKey | KAFQZFNWIPBPJR-GQHLEUQBSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.184°C at 760 mmHg (Cal.) |
| Flash point | 276.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloroxymorphamine |