|
CAS#: 7137-56-6 Product: 1-Nitro-2-Cyclohexylbenzene No suppilers available for the product. |
| Name | 1-Nitro-2-Cyclohexylbenzene |
|---|---|
| Synonyms | 1-Cyclohexyl-2-Nitro-Benzene; Nsc44833; Benzene, 1-Cyclohexyl-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 7137-56-6 |
| SMILES | C1=CC=CC(=C1C2CCCCC2)[N+]([O-])=O |
| InChI | 1S/C12H15NO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | MKINGJJRCVBTRI-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.862°C at 760 mmHg (Cal.) |
| Flash point | 131.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2-Cyclohexylbenzene |