|
CAS#: 71412-07-2 Product: 7-Amino-(4-Aminophenyl)-4-Hydroxynaphthalene-2-Sulphonic Acid No suppilers available for the product. |
| Name | 7-Amino-(4-Aminophenyl)-4-Hydroxynaphthalene-2-Sulphonic Acid |
|---|---|
| Synonyms | 7-[(4-Aminophenyl)Amino]-4-Hydroxy-Naphthalene-2-Sulfonic Acid; 7-[(4-Aminophenyl)Amino]-4-Hydroxy-2-Naphthalenesulfonic Acid; 7-Amino-(4-Aminophenyl)-4-Hydroxynaphthalene-2-Sulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.36 |
| CAS Registry Number | 71412-07-2 |
| EINECS | 275-415-5 |
| SMILES | C1=C2C(=C(O)C=C1[S](=O)(=O)O)C=CC(=C2)NC3=CC=C(N)C=C3 |
| InChI | 1S/C16H14N2O4S/c17-11-1-3-12(4-2-11)18-13-5-6-15-10(7-13)8-14(9-16(15)19)23(20,21)22/h1-9,18-19H,17H2,(H,20,21,22) |
| InChIKey | ONLXYPUSSBYREN-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-Amino-(4-Aminophenyl)-4-Hydroxynaphthalene-2-Sulphonic Acid |