|
CAS#: 71412-20-9 Product: 7-(3-Bromo-2-Oxopropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 7-(3-Bromo-2-Oxopropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |
|---|---|
| Synonyms | 7-(3-Bromo-2-Oxo-Propyl)-1,3-Dimethyl-Purine-2,6-Dione; 7-(3-Bromo-2-Keto-Propyl)-1,3-Dimethyl-Xanthine; 7-(3-Bromo-2-Oxopropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11BrN4O3 |
| Molecular Weight | 315.13 |
| CAS Registry Number | 71412-20-9 |
| EINECS | 275-426-5 |
| SMILES | C1=NC2=C([N]1CC(=O)CBr)C(=O)N(C(=O)N2C)C |
| InChI | 1S/C10H11BrN4O3/c1-13-8-7(9(17)14(2)10(13)18)15(5-12-8)4-6(16)3-11/h5H,3-4H2,1-2H3 |
| InChIKey | CKGMJGVOFVQVCF-UHFFFAOYSA-N |
| Density | 1.786g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.119°C at 760 mmHg (Cal.) |
| Flash point | 274.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(3-Bromo-2-Oxopropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |