|
CAS#: 71412-41-4 Product: [Methylenebis(4,1-Phenylene)]Bis(Carbamic Acid)Bis(2-Methylbutyl) Ester No suppilers available for the product. |
| Name | [Methylenebis(4,1-Phenylene)]Bis(Carbamic Acid)Bis(2-Methylbutyl) Ester |
|---|---|
| Synonyms | N-[4-[[4-[[[(2R)-2-Methylbutoxy]-Oxomethyl]Amino]Phenyl]Methyl]Phenyl]Carbamic Acid [(2R)-2-Methylbutyl] Ester; N-[4-[4-[[(2R)-2-Methylbutoxy]Carbonylamino]Benzyl]Phenyl]Carbamic Acid [(2R)-2-Methylbutyl] Ester; Carbamic Acid, (Methylene-Di-4,1-Phenylene)Bis-, Bis(2-Methylbutyl Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.55 |
| CAS Registry Number | 71412-41-4 |
| SMILES | [C@H](COC(NC2=CC=C(CC1=CC=C(C=C1)NC(=O)OC[C@@H](CC)C)C=C2)=O)(CC)C |
| InChI | 1S/C25H34N2O4/c1-5-18(3)16-30-24(28)26-22-11-7-20(8-12-22)15-21-9-13-23(14-10-21)27-25(29)31-17-19(4)6-2/h7-14,18-19H,5-6,15-17H2,1-4H3,(H,26,28)(H,27,29)/t18-,19-/m1/s1 |
| InChIKey | QZERSIIYAJUVIP-RTBURBONSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.099°C at 760 mmHg (Cal.) |
| Flash point | 250.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Methylenebis(4,1-Phenylene)]Bis(Carbamic Acid)Bis(2-Methylbutyl) Ester |