|
CAS#: 71463-47-3 Product: N-(1,3-Benzothiazol-2-ylsulfanyl)-1,1-dichloro-1-hexanamine No suppilers available for the product. |
| Name | N-(1,3-Benzothiazol-2-ylsulfanyl)-1,1-dichloro-1-hexanamine |
|---|---|
| Synonyms | N-(dichlorohexyl)-2-benzothiazolesulphenoamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16Cl2N2S2 |
| Molecular Weight | 335.32 |
| CAS Registry Number | 71463-47-3 |
| EINECS | 275-485-7 |
| SMILES | CCCCCC(Cl)(Cl)NSc1nc2ccccc2s1 |
| InChI | 1S/C13H16Cl2N2S2/c1-2-3-6-9-13(14,15)17-19-12-16-10-7-4-5-8-11(10)18-12/h4-5,7-8,17H,2-3,6,9H2,1H3 |
| InChIKey | STYZNPMPOLVSPL-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.874°C at 760 mmHg (Cal.) |
| Flash point | 207.128°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1,3-Benzothiazol-2-ylsulfanyl)-1,1-dichloro-1-hexanamine |