|
CAS#: 71463-58-6 Product: 1-(2,6-Dichlorophenyl)-3-Methylurea No suppilers available for the product. |
| Name | 1-(2,6-Dichlorophenyl)-3-Methylurea |
|---|---|
| Synonyms | 1-(2,6-Dichlorophenyl)-3-Methyl-Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 |
| CAS Registry Number | 71463-58-6 |
| EINECS | 275-497-2 |
| SMILES | C1=C(C(=C(C=C1)Cl)NC(NC)=O)Cl |
| InChI | 1S/C8H8Cl2N2O/c1-11-8(13)12-7-5(9)3-2-4-6(7)10/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | GZGMPIOPYIEASI-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.054°C at 760 mmHg (Cal.) |
| Flash point | 126.196°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dichlorophenyl)-3-Methylurea |