|
CAS#: 71477-21-9 Product: 6,7-Diamino-1,4-Dihydroquinoxaline-2,3-Dione Hydrochloride No suppilers available for the product. |
| Name | 6,7-Diamino-1,4-Dihydroquinoxaline-2,3-Dione Hydrochloride |
|---|---|
| Synonyms | 6,7-Diamino-1,4-Dihydroquinoxaline-2,3-Quinone Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 |
| CAS Registry Number | 71477-21-9 |
| EINECS | 275-511-7 |
| SMILES | [H+].C1=C(N)C(=CC2=C1NC(=O)C(=O)N2)N.[Cl-] |
| InChI | 1S/C8H8N4O2.ClH/c9-3-1-5-6(2-4(3)10)12-8(14)7(13)11-5;/h1-2H,9-10H2,(H,11,13)(H,12,14);1H |
| InChIKey | LIPIIKOCKAUSQD-UHFFFAOYSA-N |
| Boiling point | 481.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 244.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Diamino-1,4-Dihydroquinoxaline-2,3-Dione Hydrochloride |