|
CAS#: 71501-41-2 Product: Bis(2-Chlorocyclopentyl) Ketone No suppilers available for the product. |
| Name | Bis(2-Chlorocyclopentyl) Ketone |
|---|---|
| Synonyms | Bis(2-Chlorocyclopentyl) Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16Cl2O |
| Molecular Weight | 235.15 |
| CAS Registry Number | 71501-41-2 |
| EINECS | 275-569-3 |
| SMILES | O=C(C1C(Cl)CCC1)C2C(Cl)CCC2 |
| InChI | 1S/C11H16Cl2O/c12-9-5-1-3-7(9)11(14)8-4-2-6-10(8)13/h7-10H,1-6H2 |
| InChIKey | XUHWMEBMZCGMMW-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.058°C at 760 mmHg (Cal.) |
| Flash point | 148.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Chlorocyclopentyl) Ketone |