|
CAS#: 71518-15-5 Product: 1-Methyl-5-Nitro-1H-Imidazole-4-Sulfonamide No suppilers available for the product. |
| Name | 1-Methyl-5-Nitro-1H-Imidazole-4-Sulfonamide |
|---|---|
| Synonyms | 1-Methyl-5-Nitro-Imidazole-4-Sulfonamide; 1-Methyl-5-Nitro-4-Imidazolesulfonamide; Nsc521981 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6N4O4S |
| Molecular Weight | 206.18 |
| CAS Registry Number | 71518-15-5 |
| SMILES | C1=NC(=C([N+]([O-])=O)[N]1C)[S](=O)(=O)N |
| InChI | 1S/C4H6N4O4S/c1-7-2-6-3(13(5,11)12)4(7)8(9)10/h2H,1H3,(H2,5,11,12) |
| InChIKey | PSVBNWGDMOPOKM-UHFFFAOYSA-N |
| Density | 1.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.997°C at 760 mmHg (Cal.) |
| Flash point | 294.895°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-5-Nitro-1H-Imidazole-4-Sulfonamide |