|
CAS#: 71519-99-8 Product: N-[3-(Acetylamino)Phenyl]-N-(2-Carboxyethyl)-beta-Alanine No suppilers available for the product. |
| Name | N-[3-(Acetylamino)Phenyl]-N-(2-Carboxyethyl)-beta-Alanine |
|---|---|
| Synonyms | 3-[(3-Acetamidophenyl)-(2-Carboxyethyl)Amino]Propionic Acid; 3-(Acetylamino)-N,N-Bis(2-Carboxyethyl)Aniline; Beta-Alanine, N-(3-(Acetylamino)Phenyl)-N-(2-Carboxyethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 |
| CAS Registry Number | 71519-99-8 |
| SMILES | C1=CC(=CC(=C1)NC(=O)C)N(CCC(=O)O)CCC(=O)O |
| InChI | 1S/C14H18N2O5/c1-10(17)15-11-3-2-4-12(9-11)16(7-5-13(18)19)8-6-14(20)21/h2-4,9H,5-8H2,1H3,(H,15,17)(H,18,19)(H,20,21) |
| InChIKey | AABCQOXPDASHKV-UHFFFAOYSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.347°C at 760 mmHg (Cal.) |
| Flash point | 336.232°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[3-(Acetylamino)Phenyl]-N-(2-Carboxyethyl)-beta-Alanine |