|
CAS#: 7153-52-8 Product: 4-Tert-Butyl-2-[(Tert-Butylamino)Methyl]Phenol No suppilers available for the product. |
| Name | 4-Tert-Butyl-2-[(Tert-Butylamino)Methyl]Phenol |
|---|---|
| Synonyms | Nsc48150 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 |
| CAS Registry Number | 7153-52-8 |
| SMILES | C1=CC(=CC(=C1O)CNC(C)(C)C)C(C)(C)C |
| InChI | 1S/C15H25NO/c1-14(2,3)12-7-8-13(17)11(9-12)10-16-15(4,5)6/h7-9,16-17H,10H2,1-6H3 |
| InChIKey | KZVDGCKVHOQOHP-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.805°C at 760 mmHg (Cal.) |
| Flash point | 54.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butyl-2-[(Tert-Butylamino)Methyl]Phenol |