|
CAS#: 71550-35-1 Product: [1-Chloro-1-(Dimethylamino)Ethyl]Phosphonic Acid No suppilers available for the product. |
| Name | [1-Chloro-1-(Dimethylamino)Ethyl]Phosphonic Acid |
|---|---|
| Synonyms | [(1R)-1-Chloro-1-Dimethylamino-Ethyl]Phosphonic Acid; Phosphonic Acid, (1-Chloro-1-(Dimethylamino)Ethyl)-; 1-(Dimethylamino)-1-Chloroethane-1-Phosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C4H11ClNO3P |
| Molecular Weight | 187.56 |
| CAS Registry Number | 71550-35-1 |
| SMILES | [C@@](Cl)([P](=O)(O)O)(N(C)C)C |
| InChI | 1S/C4H11ClNO3P/c1-4(5,6(2)3)10(7,8)9/h1-3H3,(H2,7,8,9)/t4-/m1/s1 |
| InChIKey | QTSXVZKMXPJJMS-SCSAIBSYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.534°C at 760 mmHg (Cal.) |
| Flash point | 120.439°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1-Chloro-1-(Dimethylamino)Ethyl]Phosphonic Acid |