|
CAS#: 7159-34-4 Product: Pyroxychlor No suppilers available for the product. |
| Name | Pyroxychlor |
|---|---|
| Synonyms | 4-Picoline, 2-Chloro-6-Methoxy-Alpha,Alpha,Alpha-Trichloro-; Brn 1529945; Caswell No. 194C |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5Cl4NO |
| Molecular Weight | 260.93 |
| CAS Registry Number | 7159-34-4 |
| SMILES | C1=C(C=C(N=C1OC)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C7H5Cl4NO/c1-13-6-3-4(7(9,10)11)2-5(8)12-6/h2-3H,1H3 |
| InChIKey | RPCKKUFLSMORHB-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.108°C at 760 mmHg (Cal.) |
| Flash point | 137.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyroxychlor |