|
CAS#: 71662-30-1 Product: 9-Aminophenazin-2-Ol No suppilers available for the product. |
| Name | 9-Aminophenazin-2-Ol |
|---|---|
| Synonyms | 9-Aminophenazin-2-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 |
| CAS Registry Number | 71662-30-1 |
| EINECS | 275-796-8 |
| SMILES | C3=C2N=C1C(=CC(=O)C=C1)NC2=C(N)C=C3 |
| InChI | 1S/C12H9N3O/c13-8-2-1-3-10-12(8)15-11-6-7(16)4-5-9(11)14-10/h1-6,15H,13H2 |
| InChIKey | YVTDUOPTXDGRCC-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.189°C at 760 mmHg (Cal.) |
| Flash point | 203.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Aminophenazin-2-Ol |