|
CAS#: 71673-20-6 Product: 1-[2-(2-Ethoxyethoxy)Ethyl]-1,2,3,4-Tetrahydro-2,2,4-Trimethylquinoline No suppilers available for the product. |
| Name | 1-[2-(2-Ethoxyethoxy)Ethyl]-1,2,3,4-Tetrahydro-2,2,4-Trimethylquinoline |
|---|---|
| Synonyms | 1-(2-(2-Ethoxyethoxy)Ethyl)-2,2,4-Trimethyl-1,2,3,4-Tetrahydroquinoline; Quinoline, 1-(2-(2-Ethoxyethoxy)Ethyl)-1,2,3,4-Tetrahydro-2,2,4-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 |
| CAS Registry Number | 71673-20-6 |
| SMILES | [C@@H]2(C1=C(C=CC=C1)N(C(C2)(C)C)CCOCCOCC)C |
| InChI | 1S/C18H29NO2/c1-5-20-12-13-21-11-10-19-17-9-7-6-8-16(17)15(2)14-18(19,3)4/h6-9,15H,5,10-14H2,1-4H3/t15-/m1/s1 |
| InChIKey | LHUHRYNUYWOJFX-OAHLLOKOSA-N |
| Density | 0.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.725°C at 760 mmHg (Cal.) |
| Flash point | 105.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(2-Ethoxyethoxy)Ethyl]-1,2,3,4-Tetrahydro-2,2,4-Trimethylquinoline |