|
CAS#: 71720-45-1 Product: 4-(3-Nitrophenyl)-6-(4-Nitrophenyl)-2-(p-Tolyl)Pyridine No suppilers available for the product. |
| Name | 4-(3-Nitrophenyl)-6-(4-Nitrophenyl)-2-(p-Tolyl)Pyridine |
|---|---|
| Synonyms | 4-(3-Nitrophenyl)-6-(4-Nitrophenyl)-2-(P-Tolyl)Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 |
| CAS Registry Number | 71720-45-1 |
| EINECS | 275-894-0 |
| SMILES | C1=C(N=C(C=C1C2=CC(=CC=C2)[N+]([O-])=O)C3=CC=C(C=C3)C)C4=CC=C([N+]([O-])=O)C=C4 |
| InChI | 1S/C24H17N3O4/c1-16-5-7-17(8-6-16)23-14-20(19-3-2-4-22(13-19)27(30)31)15-24(25-23)18-9-11-21(12-10-18)26(28)29/h2-15H,1H3 |
| InChIKey | JSRNHJSABGMMTB-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.536°C at 760 mmHg (Cal.) |
| Flash point | 304.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Nitrophenyl)-6-(4-Nitrophenyl)-2-(p-Tolyl)Pyridine |