|
CAS#: 71720-57-5 Product: 2-(2-Benzylphenoxy)-N,N-dimethylethanaminium 3,4-dicarboxy-3-hydroxybutanoate hydrochloride (1:1:1) No suppilers available for the product. |
| Name | 2-(2-Benzylphenoxy)-N,N-dimethylethanaminium 3,4-dicarboxy-3-hydroxybutanoate hydrochloride (1:1:1) |
|---|---|
| Synonyms | [2-(2-ben |
| Molecular Structure | ![]() |
| Molecular Formula | C23H30ClNO8 |
| Molecular Weight | 483.94 |
| CAS Registry Number | 71720-57-5 |
| EINECS | 275-905-9 |
| SMILES | Cl.OC(=O)C(O)(CC(O)=O)CC([O-])=O.C[NH+](C)CCOc2ccccc2Cc1ccccc1 |
| InChI | 1S/C17H21NO.C6H8O7.ClH/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15;7-3(8)1-6(13,5(11)12)2-4(9)10;/h3-11H,12-14H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H |
| InChIKey | IDHSJDMEPAXBNG-UHFFFAOYSA-N |
| Boiling point | 595.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 313.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Benzylphenoxy)-N,N-dimethylethanaminium 3,4-dicarboxy-3-hydroxybutanoate hydrochloride (1:1:1) |