|
CAS#: 71735-36-9 Product: Naphtho[1,8-cd][1,2]oxathiole-5-sulfonic acid 2,2-dioxide No suppilers available for the product. |
| Name | Naphtho[1,8-cd][1,2]oxathiole-5-sulfonic acid 2,2-dioxide |
|---|---|
| Synonyms | naphth[1,8-cd]-1,2-oxathiole-5-sulphonic acid 2,2-dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O6S2 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 71735-36-9 |
| EINECS | 275-948-3 |
| SMILES | OS(=O)(=O)c3ccc1c2c3cccc2OS1(=O)=O |
| InChI | 1S/C10H6O6S2/c11-17(12,13)8-4-5-9-10-6(8)2-1-3-7(10)16-18(9,14)15/h1-5H,(H,11,12,13) |
| InChIKey | NXJNYTLKBYZZQF-UHFFFAOYSA-N |
| Density | 1.843g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Naphtho[1,8-cd][1,2]oxathiole-5-sulfonic acid 2,2-dioxide |