|
CAS#: 71750-43-1 Product: Methyl 3,4-Dimethoxynitrobenzoate No suppilers available for the product. |
| Name | Methyl 3,4-Dimethoxynitrobenzoate |
|---|---|
| Synonyms | Methyl 3,4-Dimethoxy-2-Nitro-Benzoate; 3,4-Dimethoxy-2-Nitrobenzoic Acid Methyl Ester; 3,4-Dimethoxy-2-Nitro-Benzoic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 |
| CAS Registry Number | 71750-43-1 |
| EINECS | 275-975-0 |
| SMILES | C1=CC(=C([N+]([O-])=O)C(=C1OC)OC)C(OC)=O |
| InChI | 1S/C10H11NO6/c1-15-7-5-4-6(10(12)17-3)8(11(13)14)9(7)16-2/h4-5H,1-3H3 |
| InChIKey | ZGIUTJWCSIHWGS-UHFFFAOYSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.836°C at 760 mmHg (Cal.) |
| Flash point | 170.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,4-Dimethoxynitrobenzoate |