|
CAS#: 71765-94-1 Product: 16 alpha-Iodoestradiol No suppilers available for the product. |
| Name | 16 alpha-Iodoestradiol |
|---|---|
| Synonyms | 16Alpha-Iodo-3,17Beta-Estradiol; 16Alpha-Iodoestradiol; Estra-1,3,5(10)-Triene-3,17-Diol, 16-Iodo-, (16Alpha,17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23IO2 |
| Molecular Weight | 398.28 |
| CAS Registry Number | 71765-94-1 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2CC[C@]4([C@H]3C[C@H]([C@@H]4O)I)C |
| InChI | 1S/C18H23IO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | SSYGGPAGDDGXAF-ZXXIGWHRSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.451°C at 760 mmHg (Cal.) |
| Flash point | 261.907°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16 alpha-Iodoestradiol |