|
CAS#: 71816-20-1 Product: epsilon-N-Methionyl-Lysine No suppilers available for the product. |
| Name | epsilon-N-Methionyl-Lysine |
|---|---|
| Synonyms | (2S)-2-Amino-6-[[(2S)-2-Amino-4-Methylsulfanyl-Butanoyl]Amino]Hexanoic Acid; (2S)-2-Amino-6-[[(2S)-2-Amino-4-(Methylthio)-1-Oxobutyl]Amino]Hexanoic Acid; (2S)-2-Amino-6-[[(2S)-2-Amino-4-(Methylthio)Butanoyl]Amino]Hexanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.38 |
| CAS Registry Number | 71816-20-1 |
| SMILES | [C@H](C(=O)O)(N)CCCCNC([C@@H](N)CCSC)=O |
| InChI | 1S/C11H23N3O3S/c1-18-7-5-8(12)10(15)14-6-3-2-4-9(13)11(16)17/h8-9H,2-7,12-13H2,1H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | QNAISRNXSIMUNW-IUCAKERBSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.732°C at 760 mmHg (Cal.) |
| Flash point | 285.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for epsilon-N-Methionyl-Lysine |