|
CAS#: 71832-33-2 Product: Ethyl(5-Isocyanato-2-Methylphenyl)Carbamoyl Chloride No suppilers available for the product. |
| Name | Ethyl(5-Isocyanato-2-Methylphenyl)Carbamoyl Chloride |
|---|---|
| Synonyms | N-Ethyl-N-(5-Isocyanato-2-Methyl-Phenyl)Carbamoyl Chloride; Carbamic Chloride, Ethyl(5-Isocyanato-2-Methylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 |
| CAS Registry Number | 71832-33-2 |
| EINECS | 276-048-3 |
| SMILES | O=C=NC1=CC=C(C(=C1)N(C(=O)Cl)CC)C |
| InChI | 1S/C11H11ClN2O2/c1-3-14(11(12)16)10-6-9(13-7-15)5-4-8(10)2/h4-6H,3H2,1-2H3 |
| InChIKey | JZKGLBABVFZFIL-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.612°C at 760 mmHg (Cal.) |
| Flash point | 191.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl(5-Isocyanato-2-Methylphenyl)Carbamoyl Chloride |