|
CAS#: 71850-78-7 Product: 2,3-Dimethyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-2-Butenal No suppilers available for the product. |
| Name | 2,3-Dimethyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-2-Butenal |
|---|---|
| Synonyms | 2,3-Dimethyl-4-(2,2,6-Trimethyl-5-Cyclohexenyl-1)-2-Buten-1-Al; 2,3-Dimethyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-2-Butenal; 2-Butenal, 2,3-Dimethyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 71850-78-7 |
| EINECS | 276-097-0 |
| SMILES | C(C1=C(CCCC1(C)C)C)\C(=C(C=O)/C)C |
| InChI | 1S/C15H24O/c1-11-7-6-8-15(4,5)14(11)9-12(2)13(3)10-16/h10H,6-9H2,1-5H3/b13-12+ |
| InChIKey | CQCCAGSSRPAZNY-OUKQBFOZSA-N |
| Density | 0.888g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.839°C at 760 mmHg (Cal.) |
| Flash point | 138.269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-2-Butenal |