|
CAS#: 71913-08-1 Product: 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-2-ene-2-carboxylic acid No suppilers available for the product. |
| Name | 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-2-ene-2-carboxylic acid |
|---|---|
| Synonyms | methyl hydrogen bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 71913-08-1 |
| EINECS | 276-178-0 |
| SMILES | O=C(OC)C2=C(C1CCC2C1)C(O)=O |
| InChI | 1S/C10H12O4/c1-14-10(13)8-6-3-2-5(4-6)7(8)9(11)12/h5-6H,2-4H2,1H3,(H,11,12) |
| InChIKey | KONDLVQKCUJIEN-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.457°C at 760 mmHg (Cal.) |
| Flash point | 130.306°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-2-ene-2-carboxylic acid |