Online Database of Chemicals from Around the World
|
CAS#: 71925-16-1 Product: 1,2,3,6,8-Pentachlorodibenzo[1,4]Dioxin No suppilers available for the product. |
| Name | 1,2,3,6,8-Pentachlorodibenzo[1,4]Dioxin |
|---|---|
| Synonyms | Dibenzo-P-Dioxin, 1,2,3,6,8-Pentachloro; 1,2,3,6,8-Pentachlorodibenzodioxin; 1,2,3,6,8-Pentachlorodibenzo-P-Dioxin |
| Molecular Structure | ![CAS#: 71925-16-1, 1,2,3,6,8-Pentachlorodibenzo[1,4]Dioxin](/moreStructures/71925-16-1.gif) |
| Molecular Formula | C12H3Cl5O2 |
| Molecular Weight | 356.42 |
| CAS Registry Number | 71925-16-1 |
| SMILES | C3=C2OC1=C(C=C(C=C1OC2=C(C(=C3Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O2/c13-4-1-6(15)11-7(2-4)19-12-8(18-11)3-5(14)9(16)10(12)17/h1-3H |
| InChIKey | VKDGHBBUEIIEHL-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.103°C at 760 mmHg (Cal.) |
| Flash point | 172.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6,8-Pentachlorodibenzo[1,4]Dioxin |