|
CAS#: 71989-99-6 Product: 2-(2,3,4-Trimethoxyphenyl)Propionic Acid No suppilers available for the product. |
| Name | 2-(2,3,4-Trimethoxyphenyl)Propionic Acid |
|---|---|
| Synonyms | 2-(2,3,4-Trimethoxyphenyl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 71989-99-6 |
| EINECS | 276-273-7 |
| SMILES | C1=CC(=C(OC)C(=C1OC)OC)C(C(=O)O)C |
| InChI | 1S/C12H16O5/c1-7(12(13)14)8-5-6-9(15-2)11(17-4)10(8)16-3/h5-7H,1-4H3,(H,13,14) |
| InChIKey | YAURVMGBGYEPTE-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.401°C at 760 mmHg (Cal.) |
| Flash point | 140.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,3,4-Trimethoxyphenyl)Propionic Acid |