|
CAS#: 72018-24-7 Product: Azanium Hexyl Sulfate No suppilers available for the product. |
| Name | Azanium Hexyl Sulfate |
|---|---|
| Synonyms | Ammonium Hexyl Sulfate; Sulfuric Acid, Monohexyl Ester, Ammonium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H17NO4S |
| Molecular Weight | 199.26 |
| CAS Registry Number | 72018-24-7 |
| SMILES | C(CCC)CCO[S]([O-])(=O)=O.[NH4+] |
| InChI | 1S/C6H14O4S.H3N/c1-2-3-4-5-6-10-11(7,8)9;/h2-6H2,1H3,(H,7,8,9);1H3 |
| InChIKey | GDWRXJCWAANTID-UHFFFAOYSA-N |
| Boiling point | 338.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 158.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azanium Hexyl Sulfate |