|
CAS#: 72036-57-8 Product: 3-(4-Aminophenyl)-5,5-Dimethylcyclohex-2-En-1-One No suppilers available for the product. |
| Name | 3-(4-Aminophenyl)-5,5-Dimethylcyclohex-2-En-1-One |
|---|---|
| Synonyms | 3-(4-Aminophenyl)-5,5-Dimethyl-Cyclohex-2-En-1-One; 3-(4-Aminophenyl)-5,5-Dimethyl-1-Cyclohex-2-Enone; 5,5-Dimethyl-3-(4-Aminophenyl)Cyclohex-2-Enone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.29 |
| CAS Registry Number | 72036-57-8 |
| SMILES | C2=C(C1=CC(=O)CC(C1)(C)C)C=CC(=C2)N |
| InChI | 1S/C14H17NO/c1-14(2)8-11(7-13(16)9-14)10-3-5-12(15)6-4-10/h3-7H,8-9,15H2,1-2H3 |
| InChIKey | KMDFZRUKDNJUKH-UHFFFAOYSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.761°C at 760 mmHg (Cal.) |
| Flash point | 166.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Aminophenyl)-5,5-Dimethylcyclohex-2-En-1-One |