|
CAS#: 72075-06-0 Product: 2-Deoxy-Scyllo-Inosamine No suppilers available for the product. |
| Name | 2-Deoxy-Scyllo-Inosamine |
|---|---|
| Synonyms | 2,3,4,5-Tetrahydrocyclohexylamine 3,5/2,4; 2-Deoxy-Scyllo-Inosamine; Dl-Scyllo-Inositol, 1-Amino-1,2-Dideoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 72075-06-0 (75419-36-2) |
| SMILES | [C@@H]1(O)[C@@H](O)[C@H](O)C[C@H](N)[C@H]1O |
| InChI | 1S/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | QXQNRSUOYNMXDL-KGJVWPDLSA-N |
| Density | 1.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.92°C at 760 mmHg (Cal.) |
| Flash point | 136.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxy-Scyllo-Inosamine |